C13H17BrN2O5S — CID 119220969
3-[3-[(3-bromophenyl)sulfonylamino]propanoylamino]butanoic acid (PubChem CID 119220969) has the molecular formula C13H17BrN2O5S and a molecular weight of 393.26 g/mol. Its IUPAC name is 3-[3-[(3-bromophenyl)sulfonylamino]propanoylamino]butanoic acid.
| Compound Name | 3-[3-[(3-bromophenyl)sulfonylamino]propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119220969 |
| Molecular Formula | C13H17BrN2O5S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 3-[3-[(3-bromophenyl)sulfonylamino]propanoylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)CCNS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H17BrN2O5S/c1-9(7-13(18)19)16-12(17)5-6-15-22(20,21)11-4-2-3-10(14)8-11/h2-4,8-9,15H,5-7H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | CKTSAWYQVYTTCJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |