C14H17NO3 — CID 119221067
3-(2,3-dihydro-1H-indene-1-carbonylamino)butanoic acid (PubChem CID 119221067) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indene-1-carbonylamino)butanoic acid.
| Compound Name | 3-(2,3-dihydro-1H-indene-1-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 119221067 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3-(2,3-dihydro-1H-indene-1-carbonylamino)butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)C1CCc2ccccc21 |
| InChI | InChI=1S/C14H17NO3/c1-9(8-13(16)17)15-14(18)12-7-6-10-4-2-3-5-11(10)12/h2-5,9,12H,6-8H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | KFLIOMCAKUSFGZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |