C15H18F3NO3 — CID 119221372
3-[3-[3-(trifluoromethyl)phenyl]butanoylamino]butanoic acid (PubChem CID 119221372) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is 3-[3-[3-(trifluoromethyl)phenyl]butanoylamino]butanoic acid.
| Compound Name | 3-[3-[3-(trifluoromethyl)phenyl]butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119221372 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-[3-[3-(trifluoromethyl)phenyl]butanoylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)CC(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F3NO3/c1-9(6-13(20)19-10(2)7-14(21)22)11-4-3-5-12(8-11)15(16,17)18/h3-5,8-10H,6-7H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | MRGMQYCOMMXWQX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |