About 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid
5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 119221984) has the molecular formula C17H16FNO5
and a molecular weight of 333.32 g/mol. Its IUPAC name is 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
| PubChem CID | 119221984 |
| Molecular Formula | C17H16FNO5 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CN(C)C(=O)C2Cc3cccc(F)c3O2)cc1C(=O)O |
| InChI | InChI=1S/C17H16FNO5/c1-9-12(17(21)22)7-11(23-9)8-19(2)16(20)14-6-10-4-3-5-13(18)15(10)24-14/h3-5,7,14H,6,8H2,1-2H3,(H,21,22) |
| InChIKey | DDFHBYRHMSWDPS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid?
The IUPAC name of 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid (CID 119221984) is 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid.
What is the SMILES notation for 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid?
The canonical SMILES for 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid is Cc1oc(CN(C)C(=O)C2Cc3cccc(F)c3O2)cc1C(=O)O.
What is the InChIKey of 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid?
The InChIKey is DDFHBYRHMSWDPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FNO5/c1-9-12(17(21)22)7-11(23-9)8-19(2)16(20)14-6-10-4-3-5-13(18)15(10)24-14/h3-5,7,14H,6,8H2,1-2H3,(H,21,22).
What are the key properties of 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid?
5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid has a molecular weight of 333.32 g/mol, XLogP of 2.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(7-fluoro-2,3-dihydro-1-benzofuran-2-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid is sourced from PubChem (CID 119221984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).