C14H13NO4S — CID 119223152
5-(oxolane-3-carbonylamino)-1-benzothiophene-2-carboxylic acid (PubChem CID 119223152) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is 5-(oxolane-3-carbonylamino)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 5-(oxolane-3-carbonylamino)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 119223152 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 5-(oxolane-3-carbonylamino)-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(NC(=O)C3CCOC3)ccc2s1 |
| InChI | InChI=1S/C14H13NO4S/c16-13(8-3-4-19-7-8)15-10-1-2-11-9(5-10)6-12(20-11)14(17)18/h1-2,5-6,8H,3-4,7H2,(H,15,16)(H,17,18) |
| InChIKey | RZPMVVCXPRTBPX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |