C13H17BrN2O5S — CID 119223647
2-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]amino]butanoic acid (PubChem CID 119223647) has the molecular formula C13H17BrN2O5S and a molecular weight of 393.26 g/mol. Its IUPAC name is 2-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]amino]butanoic acid.
| Compound Name | 2-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119223647 |
| Molecular Formula | C13H17BrN2O5S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 2-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)CN(C)S(=O)(=O)c1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C13H17BrN2O5S/c1-3-11(13(18)19)15-12(17)8-16(2)22(20,21)10-6-4-9(14)5-7-10/h4-7,11H,3,8H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | USCMZGPMZOCOHV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |