C19H24N4O4 — CID 119224356
2-[[2-[4-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]phenyl]acetyl]amino]acetic acid (PubChem CID 119224356) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[[2-[4-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]phenyl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]phenyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 119224356 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[[2-[4-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]phenyl]acetyl]amino]acetic acid |
| SMILES | Cn1nc(C(C)(C)C)cc1C(=O)Nc1ccc(CC(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C19H24N4O4/c1-19(2,3)15-10-14(23(4)22-15)18(27)21-13-7-5-12(6-8-13)9-16(24)20-11-17(25)26/h5-8,10H,9,11H2,1-4H3,(H,20,24)(H,21,27)(H,25,26) |
| InChIKey | KYQFVYDTIFHBRZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |