C20H22N2O5 — CID 119224448
2-[[2-[4-[3-(4-methoxyphenyl)propanoylamino]phenyl]acetyl]amino]acetic acid (PubChem CID 119224448) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[[2-[4-[3-(4-methoxyphenyl)propanoylamino]phenyl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-[3-(4-methoxyphenyl)propanoylamino]phenyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 119224448 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[[2-[4-[3-(4-methoxyphenyl)propanoylamino]phenyl]acetyl]amino]acetic acid |
| SMILES | COc1ccc(CCC(=O)Nc2ccc(CC(=O)NCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-27-17-9-4-14(5-10-17)6-11-18(23)22-16-7-2-15(3-8-16)12-19(24)21-13-20(25)26/h2-5,7-10H,6,11-13H2,1H3,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | IWCMSUQWAMPJEG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |