C22H26N2O4 — CID 119224590
2-[[2-[4-[(2-ethyl-2-phenylbutanoyl)amino]phenyl]acetyl]amino]acetic acid (PubChem CID 119224590) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-[[2-[4-[(2-ethyl-2-phenylbutanoyl)amino]phenyl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-[(2-ethyl-2-phenylbutanoyl)amino]phenyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 119224590 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-[[2-[4-[(2-ethyl-2-phenylbutanoyl)amino]phenyl]acetyl]amino]acetic acid |
| SMILES | CCC(CC)(C(=O)Nc1ccc(CC(=O)NCC(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O4/c1-3-22(4-2,17-8-6-5-7-9-17)21(28)24-18-12-10-16(11-13-18)14-19(25)23-15-20(26)27/h5-13H,3-4,14-15H2,1-2H3,(H,23,25)(H,24,28)(H,26,27) |
| InChIKey | UZBWRFUHLGXZJM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |