About 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid
2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid (PubChem CID 119225352) has the molecular formula C22H24N2O5
and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid.
Molecular Properties
| Compound Name | 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid |
| PubChem CID | 119225352 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid |
| SMILES | COc1ccc(-c2[nH]c3ccccc3c2CCC(=O)NC(C)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O5/c1-13(22(26)27)23-20(25)11-10-16-15-6-4-5-7-18(15)24-21(16)17-9-8-14(28-2)12-19(17)29-3/h4-9,12-13,24H,10-11H2,1-3H3,(H,23,25)(H,26,27) |
| InChIKey | DYUGHBHUYMXWMN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid?
The IUPAC name of 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid (CID 119225352) is 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid.
What is the SMILES notation for 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid?
The canonical SMILES for 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid is COc1ccc(-c2[nH]c3ccccc3c2CCC(=O)NC(C)C(=O)O)c(OC)c1.
What is the InChIKey of 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid?
The InChIKey is DYUGHBHUYMXWMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O5/c1-13(22(26)27)23-20(25)11-10-16-15-6-4-5-7-18(15)24-21(16)17-9-8-14(28-2)12-19(17)29-3/h4-9,12-13,24H,10-11H2,1-3H3,(H,23,25)(H,26,27).
What are the key properties of 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid?
2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid has a molecular weight of 396.44 g/mol, XLogP of 3.37, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(2,4-dimethoxyphenyl)-1H-indol-3-yl]propanoylamino]propanoic acid is sourced from PubChem (CID 119225352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).