C18H22NO3- — CID 11922542
(2S,3S)-3-(2-phenylethylcarbamoyl)bicyclo[2.2.2]octane-2-carboxylate (PubChem CID 11922542) has the molecular formula C18H22NO3- and a molecular weight of 300.38 g/mol. Its IUPAC name is (2S,3S)-3-(2-phenylethylcarbamoyl)bicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | (2S,3S)-3-(2-phenylethylcarbamoyl)bicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 11922542 |
| Molecular Formula | C18H22NO3- |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (2S,3S)-3-(2-phenylethylcarbamoyl)bicyclo[2.2.2]octane-2-carboxylate |
| SMILES | O=C([O-])[C@H]1C2CCC(CC2)[C@@H]1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C18H23NO3/c20-17(19-11-10-12-4-2-1-3-5-12)15-13-6-8-14(9-7-13)16(15)18(21)22/h1-5,13-16H,6-11H2,(H,19,20)(H,21,22)/p-1/t13?,14?,15-,16-/m0/s1 |
| InChIKey | XOZAHVYJTCZYCE-CKUJCDMFSA-M |
| XLogP | 1.15 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |