C16H26N2O4 — CID 119225718
2-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]propanoic acid (PubChem CID 119225718) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]propanoic acid.
| Compound Name | 2-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119225718 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C1CCC(NC(=O)C2CCCC2)CC1)C(=O)O |
| InChI | InChI=1S/C16H26N2O4/c1-10(16(21)22)17-14(19)12-6-8-13(9-7-12)18-15(20)11-4-2-3-5-11/h10-13H,2-9H2,1H3,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | QDXRLYFCGDWWDE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |