C12H18N2O4 — CID 119225874
2-[(3-pentan-3-yl-1,2-oxazole-5-carbonyl)amino]propanoic acid (PubChem CID 119225874) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[(3-pentan-3-yl-1,2-oxazole-5-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(3-pentan-3-yl-1,2-oxazole-5-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119225874 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-[(3-pentan-3-yl-1,2-oxazole-5-carbonyl)amino]propanoic acid |
| SMILES | CCC(CC)c1cc(C(=O)NC(C)C(=O)O)on1 |
| InChI | InChI=1S/C12H18N2O4/c1-4-8(5-2)9-6-10(18-14-9)11(15)13-7(3)12(16)17/h6-8H,4-5H2,1-3H3,(H,13,15)(H,16,17) |
| InChIKey | QGAUFMNNTMINFP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |