C18H23N3O4 — CID 119227173
7-[(6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]heptanoic acid (PubChem CID 119227173) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 7-[(6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]heptanoic acid.
| Compound Name | 7-[(6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 119227173 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 7-[(6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]heptanoic acid |
| SMILES | Cc1noc2nc(C3CC3)cc(C(=O)NCCCCCCC(=O)O)c12 |
| InChI | InChI=1S/C18H23N3O4/c1-11-16-13(10-14(12-7-8-12)20-18(16)25-21-11)17(24)19-9-5-3-2-4-6-15(22)23/h10,12H,2-9H2,1H3,(H,19,24)(H,22,23) |
| InChIKey | ITHDSUQOHPUFPP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|