C16H25N3O3 — CID 119229364
4-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 119229364) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119229364 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 4-[(3-tert-butyl-1-methylpyrazole-5-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | Cn1nc(C(C)(C)C)cc1C(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H25N3O3/c1-16(2,3)13-9-12(19(4)18-13)14(20)17-11-7-5-10(6-8-11)15(21)22/h9-11H,5-8H2,1-4H3,(H,17,20)(H,21,22) |
| InChIKey | SFGRTZAIVUZNOW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |