C18H22F3NO3 — CID 119230390
4-[3-[4-(trifluoromethyl)phenyl]butanoylamino]cyclohexane-1-carboxylic acid (PubChem CID 119230390) has the molecular formula C18H22F3NO3 and a molecular weight of 357.37 g/mol. Its IUPAC name is 4-[3-[4-(trifluoromethyl)phenyl]butanoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-[4-(trifluoromethyl)phenyl]butanoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119230390 |
| Molecular Formula | C18H22F3NO3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-[3-[4-(trifluoromethyl)phenyl]butanoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CC(CC(=O)NC1CCC(C(=O)O)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H22F3NO3/c1-11(12-2-6-14(7-3-12)18(19,20)21)10-16(23)22-15-8-4-13(5-9-15)17(24)25/h2-3,6-7,11,13,15H,4-5,8-10H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | ICBDAIQGLXONSY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |