C11H17N3O4 — CID 119231036
2-[3-(4-ethoxybutanoylamino)pyrazol-1-yl]acetic acid (PubChem CID 119231036) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-[3-(4-ethoxybutanoylamino)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[3-(4-ethoxybutanoylamino)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 119231036 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-[3-(4-ethoxybutanoylamino)pyrazol-1-yl]acetic acid |
| SMILES | CCOCCCC(=O)Nc1ccn(CC(=O)O)n1 |
| InChI | InChI=1S/C11H17N3O4/c1-2-18-7-3-4-10(15)12-9-5-6-14(13-9)8-11(16)17/h5-6H,2-4,7-8H2,1H3,(H,16,17)(H,12,13,15) |
| InChIKey | LHVJNZFQQOCOCS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|