C22H24N2O4 — CID 119232177
2-[(4-ethoxyphenyl)methyl]-3-[(2-indol-1-ylacetyl)amino]propanoic acid (PubChem CID 119232177) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)methyl]-3-[(2-indol-1-ylacetyl)amino]propanoic acid.
| Compound Name | 2-[(4-ethoxyphenyl)methyl]-3-[(2-indol-1-ylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119232177 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[(4-ethoxyphenyl)methyl]-3-[(2-indol-1-ylacetyl)amino]propanoic acid |
| SMILES | CCOc1ccc(CC(CNC(=O)Cn2ccc3ccccc32)C(=O)O)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-2-28-19-9-7-16(8-10-19)13-18(22(26)27)14-23-21(25)15-24-12-11-17-5-3-4-6-20(17)24/h3-12,18H,2,13-15H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | BFEFYEFUOGXRKP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |