C12H15BrN2O5 — CID 119232624
3-[[2-[(5-bromofuran-2-carbonyl)-methylamino]acetyl]-methylamino]propanoic acid (PubChem CID 119232624) has the molecular formula C12H15BrN2O5 and a molecular weight of 347.17 g/mol. Its IUPAC name is 3-[[2-[(5-bromofuran-2-carbonyl)-methylamino]acetyl]-methylamino]propanoic acid.
| Compound Name | 3-[[2-[(5-bromofuran-2-carbonyl)-methylamino]acetyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119232624 |
| Molecular Formula | C12H15BrN2O5 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 3-[[2-[(5-bromofuran-2-carbonyl)-methylamino]acetyl]-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)CN(C)C(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H15BrN2O5/c1-14(6-5-11(17)18)10(16)7-15(2)12(19)8-3-4-9(13)20-8/h3-4H,5-7H2,1-2H3,(H,17,18) |
| InChIKey | UZSALXLTFYHYNH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |