2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid

C19H21NO3 — CID 119233647

IUPAC2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid
SMILESCc1ccc(C(=O)NCC(Cc2ccccc2)C(=O)O)c(C)c1
InChIInChI=1S/C19H21NO3/c1-13-8-9-17(14(2)10-13)18(21)20-12-16(19(22)23)11-15-6-4-3-5-7-15/h3-10,16H,11-12H2,1-2H3,(H,20,21)(H,22,23)
InChIKeyZFQKJEBGXLMXRU-UHFFFAOYSA-N
MW311.38 g/mol
LogP2.98
Rot. Bonds6

About 2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid

2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid (PubChem CID 119233647) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid.

Molecular Properties

Compound Name2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid
PubChem CID119233647
Molecular FormulaC19H21NO3
Molecular Weight311.38 g/mol
Exact Mass311.15
IUPAC Name2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid
SMILESCc1ccc(C(=O)NCC(Cc2ccccc2)C(=O)O)c(C)c1
InChIInChI=1S/C19H21NO3/c1-13-8-9-17(14(2)10-13)18(21)20-12-16(19(22)23)11-15-6-4-3-5-7-15/h3-10,16H,11-12H2,1-2H3,(H,20,21)(H,22,23)
InChIKeyZFQKJEBGXLMXRU-UHFFFAOYSA-N
XLogP2.98
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.38
LogP ≤ 52.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid?
The IUPAC name of 2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid (CID 119233647) is 2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid.
What is the SMILES notation for 2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid?
The canonical SMILES for 2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid is Cc1ccc(C(=O)NCC(Cc2ccccc2)C(=O)O)c(C)c1.
What is the InChIKey of 2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid?
The InChIKey is ZFQKJEBGXLMXRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3/c1-13-8-9-17(14(2)10-13)18(21)20-12-16(19(22)23)11-15-6-4-3-5-7-15/h3-10,16H,11-12H2,1-2H3,(H,20,21)(H,22,23).
What are the key properties of 2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid?
2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid has a molecular weight of 311.38 g/mol, XLogP of 2.98, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3-[(2,4-dimethylbenzoyl)amino]propanoic acid is sourced from PubChem (CID 119233647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).