C18H21Cl2N3O3 — CID 119234526
5-[[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]pentanoic acid (PubChem CID 119234526) has the molecular formula C18H21Cl2N3O3 and a molecular weight of 398.29 g/mol. Its IUPAC name is 5-[[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]pentanoic acid.
| Compound Name | 5-[[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234526 |
| Molecular Formula | C18H21Cl2N3O3 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 5-[[2-[1-(2,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]acetyl]amino]pentanoic acid |
| SMILES | Cc1nn(-c2ccc(Cl)cc2Cl)c(C)c1CC(=O)NCCCCC(=O)O |
| InChI | InChI=1S/C18H21Cl2N3O3/c1-11-14(10-17(24)21-8-4-3-5-18(25)26)12(2)23(22-11)16-7-6-13(19)9-15(16)20/h6-7,9H,3-5,8,10H2,1-2H3,(H,21,24)(H,25,26) |
| InChIKey | GMDWKIIXVLACGB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|