C18H22N2O5S — CID 119234990
5-[[2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]pentanoic acid (PubChem CID 119234990) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 5-[[2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234990 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 5-[[2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carbonyl]amino]pentanoic acid |
| SMILES | COc1ccc(-c2nc(C)c(C(=O)NCCCCC(=O)O)s2)cc1OC |
| InChI | InChI=1S/C18H22N2O5S/c1-11-16(17(23)19-9-5-4-6-15(21)22)26-18(20-11)12-7-8-13(24-2)14(10-12)25-3/h7-8,10H,4-6,9H2,1-3H3,(H,19,23)(H,21,22) |
| InChIKey | NXUUZJSBQVKMQD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|