C18H22N2O6 — CID 119235014
5-[[1-(1,3-benzodioxole-5-carbonyl)pyrrolidine-2-carbonyl]amino]pentanoic acid (PubChem CID 119235014) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is 5-[[1-(1,3-benzodioxole-5-carbonyl)pyrrolidine-2-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[1-(1,3-benzodioxole-5-carbonyl)pyrrolidine-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119235014 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 5-[[1-(1,3-benzodioxole-5-carbonyl)pyrrolidine-2-carbonyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)C1CCCN1C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H22N2O6/c21-16(22)5-1-2-8-19-17(23)13-4-3-9-20(13)18(24)12-6-7-14-15(10-12)26-11-25-14/h6-7,10,13H,1-5,8-9,11H2,(H,19,23)(H,21,22) |
| InChIKey | JVJGMTJHKITNIO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|