C12H15N3O5S — CID 119237007
3-[(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carbonyl)amino]-2-methylpropanoic acid (PubChem CID 119237007) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is 3-[(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carbonyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carbonyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119237007 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-[(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carbonyl)amino]-2-methylpropanoic acid |
| SMILES | CC(CNC(=O)C1=CC=CN2CCS(=O)(=O)N=C12)C(=O)O |
| InChI | InChI=1S/C12H15N3O5S/c1-8(12(17)18)7-13-11(16)9-3-2-4-15-5-6-21(19,20)14-10(9)15/h2-4,8H,5-7H2,1H3,(H,13,16)(H,17,18) |
| InChIKey | HOXJILFNISHIKA-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |