C15H17FN2O4 — CID 119237470
3-[[1-(2-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 119237470) has the molecular formula C15H17FN2O4 and a molecular weight of 308.31 g/mol. Its IUPAC name is 3-[[1-(2-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[[1-(2-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119237470 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-[[1-(2-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | CC(CNC(=O)C1CC(=O)N(c2ccccc2F)C1)C(=O)O |
| InChI | InChI=1S/C15H17FN2O4/c1-9(15(21)22)7-17-14(20)10-6-13(19)18(8-10)12-5-3-2-4-11(12)16/h2-5,9-10H,6-8H2,1H3,(H,17,20)(H,21,22) |
| InChIKey | SIOYSXZYSCDVLS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |