C17H30N3O+ — CID 11923823
2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide (PubChem CID 11923823) has the molecular formula C17H30N3O+ and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide.
| Compound Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 11923823 |
| Molecular Formula | C17H30N3O+ |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide |
| SMILES | CC(C)[C@@](C)(C#N)NC(=O)C[NH+]1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C17H29N3O/c1-13(2)17(3,12-18)19-16(21)11-20-9-8-14-6-4-5-7-15(14)10-20/h13-15H,4-11H2,1-3H3,(H,19,21)/p+1/t14-,15+,17+/m0/s1 |
| InChIKey | PMGULPPCAVNYLO-ZMSDIMECSA-O |
| XLogP | 1.14 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |