C16H17NO6 — CID 119238690
4-[3-(methoxymethyl)-1-benzofuran-2-carbonyl]morpholine-2-carboxylic acid (PubChem CID 119238690) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is 4-[3-(methoxymethyl)-1-benzofuran-2-carbonyl]morpholine-2-carboxylic acid.
| Compound Name | 4-[3-(methoxymethyl)-1-benzofuran-2-carbonyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 119238690 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-[3-(methoxymethyl)-1-benzofuran-2-carbonyl]morpholine-2-carboxylic acid |
| SMILES | COCc1c(C(=O)N2CCOC(C(=O)O)C2)oc2ccccc12 |
| InChI | InChI=1S/C16H17NO6/c1-21-9-11-10-4-2-3-5-12(10)23-14(11)15(18)17-6-7-22-13(8-17)16(19)20/h2-5,13H,6-9H2,1H3,(H,19,20) |
| InChIKey | CPFJMGCDBPIQLT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |