C15H16F3NO4 — CID 119238821
4-(4,4,4-trifluoro-3-phenylbutanoyl)morpholine-2-carboxylic acid (PubChem CID 119238821) has the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. Its IUPAC name is 4-(4,4,4-trifluoro-3-phenylbutanoyl)morpholine-2-carboxylic acid.
| Compound Name | 4-(4,4,4-trifluoro-3-phenylbutanoyl)morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 119238821 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 4-(4,4,4-trifluoro-3-phenylbutanoyl)morpholine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)CC(c2ccccc2)C(F)(F)F)CCO1 |
| InChI | InChI=1S/C15H16F3NO4/c16-15(17,18)11(10-4-2-1-3-5-10)8-13(20)19-6-7-23-12(9-19)14(21)22/h1-5,11-12H,6-9H2,(H,21,22) |
| InChIKey | RYMKFYSLQLEDEU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |