C19H21NO4 — CID 119240314
2-methyl-4-[[2-(3-propan-2-yloxyphenyl)acetyl]amino]benzoic acid (PubChem CID 119240314) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-methyl-4-[[2-(3-propan-2-yloxyphenyl)acetyl]amino]benzoic acid.
| Compound Name | 2-methyl-4-[[2-(3-propan-2-yloxyphenyl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 119240314 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-methyl-4-[[2-(3-propan-2-yloxyphenyl)acetyl]amino]benzoic acid |
| SMILES | Cc1cc(NC(=O)Cc2cccc(OC(C)C)c2)ccc1C(=O)O |
| InChI | InChI=1S/C19H21NO4/c1-12(2)24-16-6-4-5-14(10-16)11-18(21)20-15-7-8-17(19(22)23)13(3)9-15/h4-10,12H,11H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | FMPXQEZAGOWEHD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |