C20H21NO5S — CID 119240910
2-[[3-[2-(3-acetylphenoxy)propanoylamino]phenyl]methylsulfanyl]acetic acid (PubChem CID 119240910) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[[3-[2-(3-acetylphenoxy)propanoylamino]phenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[3-[2-(3-acetylphenoxy)propanoylamino]phenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119240910 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-[[3-[2-(3-acetylphenoxy)propanoylamino]phenyl]methylsulfanyl]acetic acid |
| SMILES | CC(=O)c1cccc(OC(C)C(=O)Nc2cccc(CSCC(=O)O)c2)c1 |
| InChI | InChI=1S/C20H21NO5S/c1-13(22)16-6-4-8-18(10-16)26-14(2)20(25)21-17-7-3-5-15(9-17)11-27-12-19(23)24/h3-10,14H,11-12H2,1-2H3,(H,21,25)(H,23,24) |
| InChIKey | OMNBOTQNGIUMCQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |