About 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid
2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119241574) has the molecular formula C11H15N3O5S
and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid |
| PubChem CID | 119241574 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid |
| SMILES | Cn1c(=O)ccn(CC(=O)NCCSCC(=O)O)c1=O |
| InChI | InChI=1S/C11H15N3O5S/c1-13-9(16)2-4-14(11(13)19)6-8(15)12-3-5-20-7-10(17)18/h2,4H,3,5-7H2,1H3,(H,12,15)(H,17,18) |
| InChIKey | LQKJUNNKTLPXKB-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid?
The IUPAC name of 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid (CID 119241574) is 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid.
What is the SMILES notation for 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid?
The canonical SMILES for 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid is Cn1c(=O)ccn(CC(=O)NCCSCC(=O)O)c1=O.
What is the InChIKey of 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid?
The InChIKey is LQKJUNNKTLPXKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O5S/c1-13-9(16)2-4-14(11(13)19)6-8(15)12-3-5-20-7-10(17)18/h2,4H,3,5-7H2,1H3,(H,12,15)(H,17,18).
What are the key properties of 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid?
2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid has a molecular weight of 301.32 g/mol, XLogP of -1.52, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethylsulfanyl]acetic acid is sourced from PubChem (CID 119241574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).