C22H24N2O5 — CID 119243616
1-[3-[(3-ethoxybenzoyl)amino]benzoyl]piperidine-2-carboxylic acid (PubChem CID 119243616) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 1-[3-[(3-ethoxybenzoyl)amino]benzoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[3-[(3-ethoxybenzoyl)amino]benzoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119243616 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[3-[(3-ethoxybenzoyl)amino]benzoyl]piperidine-2-carboxylic acid |
| SMILES | CCOc1cccc(C(=O)Nc2cccc(C(=O)N3CCCCC3C(=O)O)c2)c1 |
| InChI | InChI=1S/C22H24N2O5/c1-2-29-18-10-6-7-15(14-18)20(25)23-17-9-5-8-16(13-17)21(26)24-12-4-3-11-19(24)22(27)28/h5-10,13-14,19H,2-4,11-12H2,1H3,(H,23,25)(H,27,28) |
| InChIKey | KXYRUUPCHGRUGL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |