C16H14BrNO4 — CID 119246233
5-[[[2-(4-bromophenyl)cyclopropanecarbonyl]amino]methyl]furan-2-carboxylic acid (PubChem CID 119246233) has the molecular formula C16H14BrNO4 and a molecular weight of 364.20 g/mol. Its IUPAC name is 5-[[[2-(4-bromophenyl)cyclopropanecarbonyl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[2-(4-bromophenyl)cyclopropanecarbonyl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 119246233 |
| Molecular Formula | C16H14BrNO4 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 5-[[[2-(4-bromophenyl)cyclopropanecarbonyl]amino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)C2CC2c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C16H14BrNO4/c17-10-3-1-9(2-4-10)12-7-13(12)15(19)18-8-11-5-6-14(22-11)16(20)21/h1-6,12-13H,7-8H2,(H,18,19)(H,20,21) |
| InChIKey | MUKLAWULXGEDSN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |