C20H23NO4 — CID 119246992
4-[4-[[(2,3-dimethylbenzoyl)amino]methyl]phenoxy]butanoic acid (PubChem CID 119246992) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-[4-[[(2,3-dimethylbenzoyl)amino]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[(2,3-dimethylbenzoyl)amino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 119246992 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-[4-[[(2,3-dimethylbenzoyl)amino]methyl]phenoxy]butanoic acid |
| SMILES | Cc1cccc(C(=O)NCc2ccc(OCCCC(=O)O)cc2)c1C |
| InChI | InChI=1S/C20H23NO4/c1-14-5-3-6-18(15(14)2)20(24)21-13-16-8-10-17(11-9-16)25-12-4-7-19(22)23/h3,5-6,8-11H,4,7,12-13H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | XCCOBHMSJCPXEJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|