C16H21NO6S — CID 119247693
2-[4-(2-methylsulfonyl-3-phenylpropanoyl)morpholin-2-yl]acetic acid (PubChem CID 119247693) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is 2-[4-(2-methylsulfonyl-3-phenylpropanoyl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-(2-methylsulfonyl-3-phenylpropanoyl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119247693 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[4-(2-methylsulfonyl-3-phenylpropanoyl)morpholin-2-yl]acetic acid |
| SMILES | CS(=O)(=O)C(Cc1ccccc1)C(=O)N1CCOC(CC(=O)O)C1 |
| InChI | InChI=1S/C16H21NO6S/c1-24(21,22)14(9-12-5-3-2-4-6-12)16(20)17-7-8-23-13(11-17)10-15(18)19/h2-6,13-14H,7-11H2,1H3,(H,18,19) |
| InChIKey | ZEAFXPFYMPMBNK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |