C17H18ClN3O4 — CID 119248246
2-[4-[3-(2-chlorophenyl)-1-methylpyrazole-4-carbonyl]morpholin-2-yl]acetic acid (PubChem CID 119248246) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is 2-[4-[3-(2-chlorophenyl)-1-methylpyrazole-4-carbonyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[3-(2-chlorophenyl)-1-methylpyrazole-4-carbonyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119248246 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-[4-[3-(2-chlorophenyl)-1-methylpyrazole-4-carbonyl]morpholin-2-yl]acetic acid |
| SMILES | Cn1cc(C(=O)N2CCOC(CC(=O)O)C2)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C17H18ClN3O4/c1-20-10-13(16(19-20)12-4-2-3-5-14(12)18)17(24)21-6-7-25-11(9-21)8-15(22)23/h2-5,10-11H,6-9H2,1H3,(H,22,23) |
| InChIKey | DJEPZLYKHUODFN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |