C17H20F3NO4 — CID 119248672
2-[4-[3-[3-(trifluoromethyl)phenyl]butanoyl]morpholin-2-yl]acetic acid (PubChem CID 119248672) has the molecular formula C17H20F3NO4 and a molecular weight of 359.34 g/mol. Its IUPAC name is 2-[4-[3-[3-(trifluoromethyl)phenyl]butanoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[3-[3-(trifluoromethyl)phenyl]butanoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119248672 |
| Molecular Formula | C17H20F3NO4 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-[4-[3-[3-(trifluoromethyl)phenyl]butanoyl]morpholin-2-yl]acetic acid |
| SMILES | CC(CC(=O)N1CCOC(CC(=O)O)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H20F3NO4/c1-11(12-3-2-4-13(8-12)17(18,19)20)7-15(22)21-5-6-25-14(10-21)9-16(23)24/h2-4,8,11,14H,5-7,9-10H2,1H3,(H,23,24) |
| InChIKey | MACDDXVAEUBKRQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |