C17H19BrN2O4 — CID 119248693
2-[4-[2-(3-bromo-2-methylindol-1-yl)acetyl]morpholin-2-yl]acetic acid (PubChem CID 119248693) has the molecular formula C17H19BrN2O4 and a molecular weight of 395.25 g/mol. Its IUPAC name is 2-[4-[2-(3-bromo-2-methylindol-1-yl)acetyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[2-(3-bromo-2-methylindol-1-yl)acetyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119248693 |
| Molecular Formula | C17H19BrN2O4 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2-[4-[2-(3-bromo-2-methylindol-1-yl)acetyl]morpholin-2-yl]acetic acid |
| SMILES | Cc1c(Br)c2ccccc2n1CC(=O)N1CCOC(CC(=O)O)C1 |
| InChI | InChI=1S/C17H19BrN2O4/c1-11-17(18)13-4-2-3-5-14(13)20(11)10-15(21)19-6-7-24-12(9-19)8-16(22)23/h2-5,12H,6-10H2,1H3,(H,22,23) |
| InChIKey | NUMUQUQBSGXBNJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |