naphthalen-2-ylazanium chloride

C10H10ClN — CID 11925

IUPACnaphthalen-2-ylazanium chloride
SMILES[Cl-].[NH3+]c1ccc2ccccc2c1
InChIInChI=1S/C10H9N.ClH/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7H,11H2;1H
InChIKeyQKGIPGSKJBOHSL-UHFFFAOYSA-N
MW179.65 g/mol
LogP-1.28
Rot. Bonds

About naphthalen-2-ylazanium chloride

naphthalen-2-ylazanium chloride (PubChem CID 11925) has the molecular formula C10H10ClN and a molecular weight of 179.65 g/mol. Its IUPAC name is naphthalen-2-ylazanium chloride.

Molecular Properties

Compound Namenaphthalen-2-ylazanium chloride
PubChem CID11925
Molecular FormulaC10H10ClN
Molecular Weight179.65 g/mol
Exact Mass179.05
IUPAC Namenaphthalen-2-ylazanium chloride
SMILES[Cl-].[NH3+]c1ccc2ccccc2c1
InChIInChI=1S/C10H9N.ClH/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7H,11H2;1H
InChIKeyQKGIPGSKJBOHSL-UHFFFAOYSA-N
XLogP-1.28
TPSA27.64 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.65
LogP ≤ 5-1.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Analyze naphthalen-2-ylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of naphthalen-2-ylazanium chloride?
The IUPAC name of naphthalen-2-ylazanium chloride (CID 11925) is naphthalen-2-ylazanium chloride.
What is the SMILES notation for naphthalen-2-ylazanium chloride?
The canonical SMILES for naphthalen-2-ylazanium chloride is [Cl-].[NH3+]c1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-ylazanium chloride?
The InChIKey is QKGIPGSKJBOHSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.ClH/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7H,11H2;1H.
What are the key properties of naphthalen-2-ylazanium chloride?
naphthalen-2-ylazanium chloride has a molecular weight of 179.65 g/mol, XLogP of -1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-ylazanium chloride is sourced from PubChem (CID 11925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).