About naphthalen-2-ylazanium chloride
naphthalen-2-ylazanium chloride (PubChem CID 11925) has the molecular formula C10H10ClN
and a molecular weight of 179.65 g/mol. Its IUPAC name is naphthalen-2-ylazanium chloride.
Molecular Properties
| Compound Name | naphthalen-2-ylazanium chloride |
| PubChem CID | 11925 |
| Molecular Formula | C10H10ClN |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | naphthalen-2-ylazanium chloride |
| SMILES | [Cl-].[NH3+]c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H9N.ClH/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7H,11H2;1H |
| InChIKey | QKGIPGSKJBOHSL-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze naphthalen-2-ylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-ylazanium chloride?
The IUPAC name of naphthalen-2-ylazanium chloride (CID 11925) is naphthalen-2-ylazanium chloride.
What is the SMILES notation for naphthalen-2-ylazanium chloride?
The canonical SMILES for naphthalen-2-ylazanium chloride is [Cl-].[NH3+]c1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-ylazanium chloride?
The InChIKey is QKGIPGSKJBOHSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.ClH/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-7H,11H2;1H.
What are the key properties of naphthalen-2-ylazanium chloride?
naphthalen-2-ylazanium chloride has a molecular weight of 179.65 g/mol, XLogP of -1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-ylazanium chloride is sourced from PubChem (CID 11925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).