C17H24N5S+ — CID 11925090
1-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-4-phenyltetrazole-5-thione (PubChem CID 11925090) has the molecular formula C17H24N5S+ and a molecular weight of 330.48 g/mol. Its IUPAC name is 1-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-4-phenyltetrazole-5-thione.
| Compound Name | 1-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-4-phenyltetrazole-5-thione |
|---|---|
| PubChem CID | 11925090 |
| Molecular Formula | C17H24N5S+ |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-4-phenyltetrazole-5-thione |
| SMILES | S=c1n(C[NH+]2CCC[C@@H]3CCCC[C@@H]32)nnn1-c1ccccc1 |
| InChI | InChI=1S/C17H23N5S/c23-17-21(18-19-22(17)15-9-2-1-3-10-15)13-20-12-6-8-14-7-4-5-11-16(14)20/h1-3,9-10,14,16H,4-8,11-13H2/p+1/t14-,16-/m0/s1 |
| InChIKey | BAEQVTWCJSMQDH-HOCLYGCPSA-O |
| XLogP | 1.99 |
| TPSA | 40.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|