C18H25N4S+ — CID 11925102
2-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 11925102) has the molecular formula C18H25N4S+ and a molecular weight of 329.49 g/mol. Its IUPAC name is 2-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 11925102 |
| Molecular Formula | C18H25N4S+ |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 2-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(-c2ccccc2)cnn1C[NH+]1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C18H24N4S/c23-18-21(16-9-2-1-3-10-16)13-19-22(18)14-20-12-6-8-15-7-4-5-11-17(15)20/h1-3,9-10,13,15,17H,4-8,11-12,14H2/p+1/t15-,17-/m0/s1 |
| InChIKey | SGJNEGGBIOTPRK-RDJZCZTQSA-O |
| XLogP | 2.60 |
| TPSA | 27.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|