C18H25NO5 — CID 119251411
4-hydroxy-1-(4-pentoxybenzoyl)piperidine-4-carboxylic acid (PubChem CID 119251411) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-hydroxy-1-(4-pentoxybenzoyl)piperidine-4-carboxylic acid.
| Compound Name | 4-hydroxy-1-(4-pentoxybenzoyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251411 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-hydroxy-1-(4-pentoxybenzoyl)piperidine-4-carboxylic acid |
| SMILES | CCCCCOc1ccc(C(=O)N2CCC(O)(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C18H25NO5/c1-2-3-4-13-24-15-7-5-14(6-8-15)16(20)19-11-9-18(23,10-12-19)17(21)22/h5-8,23H,2-4,9-13H2,1H3,(H,21,22) |
| InChIKey | FYAKVZHRCJCMJD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|