C16H22N3O2S+ — CID 11925142
3-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione (PubChem CID 11925142) has the molecular formula C16H22N3O2S+ and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 11925142 |
| Molecular Formula | C16H22N3O2S+ |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]methyl]-5-(furan-2-yl)-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(-c2ccco2)nn1C[NH+]1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C16H21N3O2S/c22-16-19(17-15(21-16)14-8-4-10-20-14)11-18-9-3-6-12-5-1-2-7-13(12)18/h4,8,10,12-13H,1-3,5-7,9,11H2/p+1/t12-,13-/m0/s1 |
| InChIKey | OEIJXKVOCJDJGZ-STQMWFEESA-O |
| XLogP | 2.66 |
| TPSA | 48.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|