C18H23ClN2O5 — CID 119251591
1-[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 119251591) has the molecular formula C18H23ClN2O5 and a molecular weight of 382.84 g/mol. Its IUPAC name is 1-[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251591 |
| Molecular Formula | C18H23ClN2O5 |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | CC(C)C(NC(=O)c1ccccc1Cl)C(=O)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C18H23ClN2O5/c1-11(2)14(20-15(22)12-5-3-4-6-13(12)19)16(23)21-9-7-18(26,8-10-21)17(24)25/h3-6,11,14,26H,7-10H2,1-2H3,(H,20,22)(H,24,25) |
| InChIKey | XEFOYJCVFPPQPV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |