C20H28N4S — CID 11925226
2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 11925226) has the molecular formula C20H28N4S and a molecular weight of 356.54 g/mol. Its IUPAC name is 2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 11925226 |
| Molecular Formula | C20H28N4S |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccccc2)nn(CN2CCC[C@@H]3CCCC[C@@H]32)c1=S |
| InChI | InChI=1S/C20H28N4S/c1-2-23-19(17-10-4-3-5-11-17)21-24(20(23)25)15-22-14-8-12-16-9-6-7-13-18(16)22/h3-5,10-11,16,18H,2,6-9,12-15H2,1H3/t16-,18-/m0/s1 |
| InChIKey | CXBUHBZNCAAAIM-WMZOPIPTSA-N |
| XLogP | 4.71 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|