C14H20BrNO3S — CID 119252765
2-[[3-(4-bromothiophen-2-yl)propanoylamino]methyl]-4-methylpentanoic acid (PubChem CID 119252765) has the molecular formula C14H20BrNO3S and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-[[3-(4-bromothiophen-2-yl)propanoylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[3-(4-bromothiophen-2-yl)propanoylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119252765 |
| Molecular Formula | C14H20BrNO3S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-[[3-(4-bromothiophen-2-yl)propanoylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNC(=O)CCc1cc(Br)cs1)C(=O)O |
| InChI | InChI=1S/C14H20BrNO3S/c1-9(2)5-10(14(18)19)7-16-13(17)4-3-12-6-11(15)8-20-12/h6,8-10H,3-5,7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | REEIOFYVWHJZJX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |