C19H25ClN4S — CID 11925316
2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-(2-chlorophenyl)-4-methyl-1,2,4-triazole-3-thione (PubChem CID 11925316) has the molecular formula C19H25ClN4S and a molecular weight of 376.96 g/mol. Its IUPAC name is 2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-(2-chlorophenyl)-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-(2-chlorophenyl)-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 11925316 |
| Molecular Formula | C19H25ClN4S |
| Molecular Weight | 376.96 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-5-(2-chlorophenyl)-4-methyl-1,2,4-triazole-3-thione |
| SMILES | Cn1c(-c2ccccc2Cl)nn(CN2CCC[C@H]3CCCC[C@@H]32)c1=S |
| InChI | InChI=1S/C19H25ClN4S/c1-22-18(15-9-3-4-10-16(15)20)21-24(19(22)25)13-23-12-6-8-14-7-2-5-11-17(14)23/h3-4,9-10,14,17H,2,5-8,11-13H2,1H3/t14-,17+/m1/s1 |
| InChIKey | YCKBXVMENYIZLC-PBHICJAKSA-N |
| XLogP | 4.88 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.96 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|