C14H19NO4S — CID 119253768
2-[[(4-acetylthiophene-2-carbonyl)amino]methyl]-4-methylpentanoic acid (PubChem CID 119253768) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[[(4-acetylthiophene-2-carbonyl)amino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(4-acetylthiophene-2-carbonyl)amino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119253768 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[[(4-acetylthiophene-2-carbonyl)amino]methyl]-4-methylpentanoic acid |
| SMILES | CC(=O)c1csc(C(=O)NCC(CC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C14H19NO4S/c1-8(2)4-10(14(18)19)6-15-13(17)12-5-11(7-20-12)9(3)16/h5,7-8,10H,4,6H2,1-3H3,(H,15,17)(H,18,19) |
| InChIKey | FNOONGDBSANPPD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |