C19H21NO5S — CID 119253841
2-methyl-2-[4-[(4-methyl-3-methylsulfonylbenzoyl)amino]phenyl]propanoic acid (PubChem CID 119253841) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-methyl-2-[4-[(4-methyl-3-methylsulfonylbenzoyl)amino]phenyl]propanoic acid.
| Compound Name | 2-methyl-2-[4-[(4-methyl-3-methylsulfonylbenzoyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 119253841 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-methyl-2-[4-[(4-methyl-3-methylsulfonylbenzoyl)amino]phenyl]propanoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(C)(C)C(=O)O)cc2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C19H21NO5S/c1-12-5-6-13(11-16(12)26(4,24)25)17(21)20-15-9-7-14(8-10-15)19(2,3)18(22)23/h5-11H,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | QHWKHUCHXGOAQH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |