C20H23NO3 — CID 119254764
3-[3-(2,4-dimethylphenyl)propanoylamino]-2-phenylpropanoic acid (PubChem CID 119254764) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[3-(2,4-dimethylphenyl)propanoylamino]-2-phenylpropanoic acid.
| Compound Name | 3-[3-(2,4-dimethylphenyl)propanoylamino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 119254764 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 3-[3-(2,4-dimethylphenyl)propanoylamino]-2-phenylpropanoic acid |
| SMILES | Cc1ccc(CCC(=O)NCC(C(=O)O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H23NO3/c1-14-8-9-16(15(2)12-14)10-11-19(22)21-13-18(20(23)24)17-6-4-3-5-7-17/h3-9,12,18H,10-11,13H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | PCVKAISJYVADAM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |